C27H23FN4O2S — CID 23818892
6-[3-[1-(3-fluorophenyl)ethylideneamino]-2-(2-phenylethylimino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23818892) has the molecular formula C27H23FN4O2S and a molecular weight of 486.57 g/mol. Its IUPAC name is 6-[3-[1-(3-fluorophenyl)ethylideneamino]-2-(2-phenylethylimino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[1-(3-fluorophenyl)ethylideneamino]-2-(2-phenylethylimino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23818892 |
| Molecular Formula | C27H23FN4O2S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 6-[3-[1-(3-fluorophenyl)ethylideneamino]-2-(2-phenylethylimino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=Nn1c(-c2ccc3c(c2)NC(=O)CO3)cs/c1=N\CCc1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C27H23FN4O2S/c1-18(20-8-5-9-22(28)14-20)31-32-24(21-10-11-25-23(15-21)30-26(33)16-34-25)17-35-27(32)29-13-12-19-6-3-2-4-7-19/h2-11,14-15,17H,12-13,16H2,1H3,(H,30,33)/b29-27-,31-18? |
| InChIKey | SRLWGQXDBMQIPP-QIMXBOFYSA-N |
| XLogP | 5.10 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|