C27H23N5O2S2 — CID 23931899
6-[2-ethylimino-3-[1-(10H-phenothiazin-2-yl)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23931899) has the molecular formula C27H23N5O2S2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 6-[2-ethylimino-3-[1-(10H-phenothiazin-2-yl)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-ethylimino-3-[1-(10H-phenothiazin-2-yl)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23931899 |
| Molecular Formula | C27H23N5O2S2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 6-[2-ethylimino-3-[1-(10H-phenothiazin-2-yl)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC/N=c1\scc(-c2ccc3c(c2)NC(=O)CO3)n1N=C(C)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C27H23N5O2S2/c1-3-28-27-32(22(15-35-27)18-8-10-23-20(13-18)30-26(33)14-34-23)31-16(2)17-9-11-25-21(12-17)29-19-6-4-5-7-24(19)36-25/h4-13,15,29H,3,14H2,1-2H3,(H,30,33)/b28-27-,31-16? |
| InChIKey | GGVGGLLPABRJQJ-KIGYZEIESA-N |
| XLogP | 5.95 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|