C24H17Cl2N5O2S — CID 23965788
6-[2-(3,4-dichlorophenyl)imino-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23965788) has the molecular formula C24H17Cl2N5O2S and a molecular weight of 510.41 g/mol. Its IUPAC name is 6-[2-(3,4-dichlorophenyl)imino-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(3,4-dichlorophenyl)imino-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23965788 |
| Molecular Formula | C24H17Cl2N5O2S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | 6-[2-(3,4-dichlorophenyl)imino-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=Nn1c(-c2ccc3c(c2)NC(=O)CO3)cs/c1=N\c1ccc(Cl)c(Cl)c1)c1cccnc1 |
| InChI | InChI=1S/C24H17Cl2N5O2S/c1-14(16-3-2-8-27-11-16)30-31-21(15-4-7-22-20(9-15)29-23(32)12-33-22)13-34-24(31)28-17-5-6-18(25)19(26)10-17/h2-11,13H,12H2,1H3,(H,29,32)/b28-24-,30-14? |
| InChIKey | PHHWSRGQIKCCSJ-HVKBRBBMSA-N |
| XLogP | 5.75 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|