C24H19N5O4S — CID 135551410
6-[3-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 135551410) has the molecular formula C24H19N5O4S and a molecular weight of 473.51 g/mol. Its IUPAC name is 6-[3-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135551410 |
| Molecular Formula | C24H19N5O4S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 6-[3-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1cc(C=Nn2c(-c3ccc4c(c3)NC(=O)CO4)cs/c2=N\c2cccnc2)ccc1O |
| InChI | InChI=1S/C24H19N5O4S/c1-32-22-9-15(4-6-20(22)30)11-26-29-19(14-34-24(29)27-17-3-2-8-25-12-17)16-5-7-21-18(10-16)28-23(31)13-33-21/h2-12,14,30H,13H2,1H3,(H,28,31)/b26-11?,27-24- |
| InChIKey | IIOHGCPNSGBUQG-WFUJPFMCSA-N |
| XLogP | 3.77 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|