C24H18FN5O2S — CID 23934024
6-[3-[1-(3-fluorophenyl)ethylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23934024) has the molecular formula C24H18FN5O2S and a molecular weight of 459.51 g/mol. Its IUPAC name is 6-[3-[1-(3-fluorophenyl)ethylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[1-(3-fluorophenyl)ethylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23934024 |
| Molecular Formula | C24H18FN5O2S |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 6-[3-[1-(3-fluorophenyl)ethylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=Nn1c(-c2ccc3c(c2)NC(=O)CO3)cs/c1=N\c1cccnc1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H18FN5O2S/c1-15(16-4-2-5-18(25)10-16)29-30-21(14-33-24(30)27-19-6-3-9-26-12-19)17-7-8-22-20(11-17)28-23(31)13-32-22/h2-12,14H,13H2,1H3,(H,28,31)/b27-24-,29-15? |
| InChIKey | WLECFMJDYSISIF-HADDNJEUSA-N |
| XLogP | 4.59 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|