C26H21BrN4O3S — CID 6030525
6-[3-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(2-methoxyphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 6030525) has the molecular formula C26H21BrN4O3S and a molecular weight of 549.45 g/mol. Its IUPAC name is 6-[3-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(2-methoxyphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(2-methoxyphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 6030525 |
| Molecular Formula | C26H21BrN4O3S |
| Molecular Weight | 549.45 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | 6-[3-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(2-methoxyphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccccc1/N=c1\scc(-c2ccc3c(c2)NC(=O)CO3)n1/N=C(/C)c1cccc(Br)c1 |
| InChI | InChI=1S/C26H21BrN4O3S/c1-16(17-6-5-7-19(27)12-17)30-31-22(18-10-11-24-21(13-18)28-25(32)14-34-24)15-35-26(31)29-20-8-3-4-9-23(20)33-2/h3-13,15H,14H2,1-2H3,(H,28,32)/b29-26-,30-16- |
| InChIKey | YPGBPALWCNDAAQ-MSWYSRDISA-N |
| XLogP | 5.82 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|