C29H21N5S — CID 135848383
3-(1H-indol-3-ylmethylideneamino)-4-(4-phenylphenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 135848383) has the molecular formula C29H21N5S and a molecular weight of 471.59 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethylideneamino)-4-(4-phenylphenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine.
| Compound Name | 3-(1H-indol-3-ylmethylideneamino)-4-(4-phenylphenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135848383 |
| Molecular Formula | C29H21N5S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-(1H-indol-3-ylmethylideneamino)-4-(4-phenylphenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | C(=Nn1c(-c2ccc(-c3ccccc3)cc2)cs/c1=N\c1cccnc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H21N5S/c1-2-7-21(8-3-1)22-12-14-23(15-13-22)28-20-35-29(33-25-9-6-16-30-19-25)34(28)32-18-24-17-31-27-11-5-4-10-26(24)27/h1-20,31H/b32-18?,33-29- |
| InChIKey | NXVRGAYWYYXUCP-SQCMVGDCSA-N |
| XLogP | 6.87 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|