C26H22N4OS — CID 135799678
N-benzyl-3-(1H-indol-3-ylmethylideneamino)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 135799678) has the molecular formula C26H22N4OS and a molecular weight of 438.56 g/mol. Its IUPAC name is N-benzyl-3-(1H-indol-3-ylmethylideneamino)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-benzyl-3-(1H-indol-3-ylmethylideneamino)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135799678 |
| Molecular Formula | C26H22N4OS |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-benzyl-3-(1H-indol-3-ylmethylideneamino)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-c2cs/c(=N\Cc3ccccc3)n2N=Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H22N4OS/c1-31-22-13-11-20(12-14-22)25-18-32-26(28-15-19-7-3-2-4-8-19)30(25)29-17-21-16-27-24-10-6-5-9-23(21)24/h2-14,16-18,27H,15H2,1H3/b28-26-,29-17? |
| InChIKey | TUENQHFQOONNIH-KJXGIHTLSA-N |
| XLogP | 5.69 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|