C18H16N4S2 — CID 2457721
N-ethyl-3-(1H-indol-3-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 2457721) has the molecular formula C18H16N4S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-ethyl-3-(1H-indol-3-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-ethyl-3-(1H-indol-3-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2457721 |
| Molecular Formula | C18H16N4S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-ethyl-3-(1H-indol-3-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2cccs2)n1N=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H16N4S2/c1-2-19-18-22(16(12-24-18)17-8-5-9-23-17)21-11-13-10-20-15-7-4-3-6-14(13)15/h3-12,20H,2H2,1H3/b19-18-,21-11? |
| InChIKey | HVXQSHIEPAGJBO-ZCJNEVSZSA-N |
| XLogP | 4.56 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|