C15H15N3S3 — CID 23792028
N-ethyl-3-[(5-methylthiophen-2-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23792028) has the molecular formula C15H15N3S3 and a molecular weight of 333.51 g/mol. Its IUPAC name is N-ethyl-3-[(5-methylthiophen-2-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-ethyl-3-[(5-methylthiophen-2-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23792028 |
| Molecular Formula | C15H15N3S3 |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-ethyl-3-[(5-methylthiophen-2-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2cccs2)n1N=Cc1ccc(C)s1 |
| InChI | InChI=1S/C15H15N3S3/c1-3-16-15-18(17-9-12-7-6-11(2)21-12)13(10-20-15)14-5-4-8-19-14/h4-10H,3H2,1-2H3/b16-15-,17-9? |
| InChIKey | MEZZECIVENGLIO-JWTJGMJASA-N |
| XLogP | 4.45 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|