C13H17N3S2 — CID 3672467
3-(butan-2-ylideneamino)-N-ethyl-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 3672467) has the molecular formula C13H17N3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 3-(butan-2-ylideneamino)-N-ethyl-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-(butan-2-ylideneamino)-N-ethyl-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 3672467 |
| Molecular Formula | C13H17N3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-(butan-2-ylideneamino)-N-ethyl-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2cccs2)n1N=C(C)CC |
| InChI | InChI=1S/C13H17N3S2/c1-4-10(3)15-16-11(12-7-6-8-17-12)9-18-13(16)14-5-2/h6-9H,4-5H2,1-3H3/b14-13-,15-10? |
| InChIKey | RLPGDOVNVPLLRC-HKQCLQIRSA-N |
| XLogP | 3.83 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|