C22H27N3OS — CID 23736140
N-ethyl-4-(6-methoxynaphthalen-2-yl)-3-(4-methylpentan-2-ylideneamino)-1,3-thiazol-2-imine (PubChem CID 23736140) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is N-ethyl-4-(6-methoxynaphthalen-2-yl)-3-(4-methylpentan-2-ylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-ethyl-4-(6-methoxynaphthalen-2-yl)-3-(4-methylpentan-2-ylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23736140 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-ethyl-4-(6-methoxynaphthalen-2-yl)-3-(4-methylpentan-2-ylideneamino)-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc3cc(OC)ccc3c2)n1N=C(C)CC(C)C |
| InChI | InChI=1S/C22H27N3OS/c1-6-23-22-25(24-16(4)11-15(2)3)21(14-27-22)19-8-7-18-13-20(26-5)10-9-17(18)12-19/h7-10,12-15H,6,11H2,1-5H3/b23-22-,24-16? |
| InChIKey | YNYBQOXPPYNEDD-GKQSKKEZSA-N |
| XLogP | 5.57 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|