C24H23N3O3S — CID 23931194
5-[[2-ethylimino-4-(6-methoxynaphthalen-2-yl)-1,3-thiazol-3-yl]iminomethyl]-2-methoxyphenol (PubChem CID 23931194) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 5-[[2-ethylimino-4-(6-methoxynaphthalen-2-yl)-1,3-thiazol-3-yl]iminomethyl]-2-methoxyphenol.
| Compound Name | 5-[[2-ethylimino-4-(6-methoxynaphthalen-2-yl)-1,3-thiazol-3-yl]iminomethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 23931194 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 5-[[2-ethylimino-4-(6-methoxynaphthalen-2-yl)-1,3-thiazol-3-yl]iminomethyl]-2-methoxyphenol |
| SMILES | CC/N=c1\scc(-c2ccc3cc(OC)ccc3c2)n1N=Cc1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C24H23N3O3S/c1-4-25-24-27(26-14-16-5-10-23(30-3)22(28)11-16)21(15-31-24)19-7-6-18-13-20(29-2)9-8-17(18)12-19/h5-15,28H,4H2,1-3H3/b25-24-,26-14? |
| InChIKey | YGPLBMYUHMVCDD-JACWKWRKSA-N |
| XLogP | 4.90 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|