C20H19Br2N3O3S — CID 135581145
2,6-dibromo-4-[[4-(2,4-dimethoxyphenyl)-2-ethylimino-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135581145) has the molecular formula C20H19Br2N3O3S and a molecular weight of 541.27 g/mol. Its IUPAC name is 2,6-dibromo-4-[[4-(2,4-dimethoxyphenyl)-2-ethylimino-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2,6-dibromo-4-[[4-(2,4-dimethoxyphenyl)-2-ethylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135581145 |
| Molecular Formula | C20H19Br2N3O3S |
| Molecular Weight | 541.27 g/mol |
| Exact Mass | 538.95 |
| IUPAC Name | 2,6-dibromo-4-[[4-(2,4-dimethoxyphenyl)-2-ethylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | CC/N=c1\scc(-c2ccc(OC)cc2OC)n1N=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C20H19Br2N3O3S/c1-4-23-20-25(24-10-12-7-15(21)19(26)16(22)8-12)17(11-29-20)14-6-5-13(27-2)9-18(14)28-3/h5-11,26H,4H2,1-3H3/b23-20-,24-10? |
| InChIKey | ZQFXEHRUFRHSMJ-AUSURFIWSA-N |
| XLogP | 5.27 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.27 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|