C23H24N4O2S — CID 135755880
4-(2,4-dimethoxyphenyl)-N-ethyl-3-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 135755880) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-ethyl-3-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-ethyl-3-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135755880 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-ethyl-3-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc(OC)cc2OC)n1N=Cc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H24N4O2S/c1-5-24-23-27(25-13-19-15(2)26-20-9-7-6-8-17(19)20)21(14-30-23)18-11-10-16(28-3)12-22(18)29-4/h6-14,26H,5H2,1-4H3/b24-23-,25-13? |
| InChIKey | JQYGWZQKTRWNLV-WTBSZUDJSA-N |
| XLogP | 4.83 |
| TPSA | 63.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|