C24H20N4O2S — CID 135584364
4-(furan-2-yl)-N-(3-methoxyphenyl)-3-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 135584364) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-(3-methoxyphenyl)-3-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(furan-2-yl)-N-(3-methoxyphenyl)-3-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135584364 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-(furan-2-yl)-N-(3-methoxyphenyl)-3-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | COc1cccc(/N=c2\scc(-c3ccco3)n2N=Cc2c(C)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H20N4O2S/c1-16-20(19-9-3-4-10-21(19)26-16)14-25-28-22(23-11-6-12-30-23)15-31-24(28)27-17-7-5-8-18(13-17)29-2/h3-15,26H,1-2H3/b25-14?,27-24- |
| InChIKey | XBUVTSKAHDQLQM-VIJLLGLJSA-N |
| XLogP | 5.72 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|