C20H14FN3O3S — CID 135832353
4-[[2-(4-fluorophenyl)imino-4-(furan-2-yl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol (PubChem CID 135832353) has the molecular formula C20H14FN3O3S and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)imino-4-(furan-2-yl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol.
| Compound Name | 4-[[2-(4-fluorophenyl)imino-4-(furan-2-yl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135832353 |
| Molecular Formula | C20H14FN3O3S |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)imino-4-(furan-2-yl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(C=Nn2c(-c3ccco3)cs/c2=N\c2ccc(F)cc2)cc1O |
| InChI | InChI=1S/C20H14FN3O3S/c21-14-4-6-15(7-5-14)23-20-24(16(12-28-20)19-2-1-9-27-19)22-11-13-3-8-17(25)18(26)10-13/h1-12,25-26H/b22-11?,23-20- |
| InChIKey | FRVDJRCNAHHNGN-BJHJPELQSA-N |
| XLogP | 4.47 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|