C18H19N3OS2 — CID 23820197
4-(furan-2-yl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine (PubChem CID 23820197) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 4-(furan-2-yl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine.
| Compound Name | 4-(furan-2-yl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23820197 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-(furan-2-yl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine |
| SMILES | CSc1ccc(C=Nn2c(-c3ccco3)cs/c2=N\C(C)C)cc1 |
| InChI | InChI=1S/C18H19N3OS2/c1-13(2)20-18-21(16(12-24-18)17-5-4-10-22-17)19-11-14-6-8-15(23-3)9-7-14/h4-13H,1-3H3/b19-11?,20-18- |
| InChIKey | YNVOEVBQKNTYLC-UOANZAOFSA-N |
| XLogP | 4.72 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|