C21H18N4OS — CID 23988522
N-(2,6-dimethylphenyl)-4-(furan-2-yl)-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23988522) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(furan-2-yl)-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-(2,6-dimethylphenyl)-4-(furan-2-yl)-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23988522 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(furan-2-yl)-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | Cc1cccc(C)c1/N=c1\scc(-c2ccco2)n1N=Cc1ccncc1 |
| InChI | InChI=1S/C21H18N4OS/c1-15-5-3-6-16(2)20(15)24-21-25(23-13-17-8-10-22-11-9-17)18(14-27-21)19-7-4-12-26-19/h3-14H,1-2H3/b23-13?,24-21- |
| InChIKey | LJQRMSFLKFXFGO-HKQCODESSA-N |
| XLogP | 4.94 |
| TPSA | 55.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|