C21H15BrFN3O3S — CID 135778689
2-bromo-4-[[2-(2-fluorophenyl)imino-4-(furan-2-yl)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol (PubChem CID 135778689) has the molecular formula C21H15BrFN3O3S and a molecular weight of 488.34 g/mol. Its IUPAC name is 2-bromo-4-[[2-(2-fluorophenyl)imino-4-(furan-2-yl)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[[2-(2-fluorophenyl)imino-4-(furan-2-yl)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135778689 |
| Molecular Formula | C21H15BrFN3O3S |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | 2-bromo-4-[[2-(2-fluorophenyl)imino-4-(furan-2-yl)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(C=Nn2c(-c3ccco3)cs/c2=N\c2ccccc2F)cc(Br)c1O |
| InChI | InChI=1S/C21H15BrFN3O3S/c1-28-19-10-13(9-14(22)20(19)27)11-24-26-17(18-7-4-8-29-18)12-30-21(26)25-16-6-3-2-5-15(16)23/h2-12,27H,1H3/b24-11?,25-21- |
| InChIKey | QSZGJWSJRNLZIF-FVKDKRHGSA-N |
| XLogP | 5.54 |
| TPSA | 72.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|