C18H15Br2N3O2S — CID 135843358
2,6-dibromo-4-[[4-(2-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135843358) has the molecular formula C18H15Br2N3O2S and a molecular weight of 497.21 g/mol. Its IUPAC name is 2,6-dibromo-4-[[4-(2-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2,6-dibromo-4-[[4-(2-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135843358 |
| Molecular Formula | C18H15Br2N3O2S |
| Molecular Weight | 497.21 g/mol |
| Exact Mass | 494.93 |
| IUPAC Name | 2,6-dibromo-4-[[4-(2-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | C/N=c1\scc(-c2ccccc2OC)n1N=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C18H15Br2N3O2S/c1-21-18-23(22-9-11-7-13(19)17(24)14(20)8-11)15(10-26-18)12-5-3-4-6-16(12)25-2/h3-10,24H,1-2H3/b21-18-,22-9? |
| InChIKey | BYACKKOQVZPEPO-NCNIPKFSSA-N |
| XLogP | 4.87 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.21 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|