C18H18N4O2S — CID 23879982
4-(2,5-dimethoxyphenyl)-N-methyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23879982) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-methyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-methyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23879982 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-methyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2cc(OC)ccc2OC)n1N=Cc1ccncc1 |
| InChI | InChI=1S/C18H18N4O2S/c1-19-18-22(21-11-13-6-8-20-9-7-13)16(12-25-18)15-10-14(23-2)4-5-17(15)24-3/h4-12H,1-3H3/b19-18-,21-11? |
| InChIKey | ZSUWQESISWYXRD-ZCJNEVSZSA-N |
| XLogP | 3.04 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|