C19H18IN3O2S — CID 23855315
4-(2,5-dimethoxyphenyl)-3-[(2-iodophenyl)methylideneamino]-N-methyl-1,3-thiazol-2-imine (PubChem CID 23855315) has the molecular formula C19H18IN3O2S and a molecular weight of 479.34 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-3-[(2-iodophenyl)methylideneamino]-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-3-[(2-iodophenyl)methylideneamino]-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23855315 |
| Molecular Formula | C19H18IN3O2S |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-3-[(2-iodophenyl)methylideneamino]-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2cc(OC)ccc2OC)n1N=Cc1ccccc1I |
| InChI | InChI=1S/C19H18IN3O2S/c1-21-19-23(22-11-13-6-4-5-7-16(13)20)17(12-26-19)15-10-14(24-2)8-9-18(15)25-3/h4-12H,1-3H3/b21-19-,22-11? |
| InChIKey | UESKXXOMHHTTLP-VXVAVIQKSA-N |
| XLogP | 4.25 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|