C27H24N4O2S — CID 6906089
4-[(E)-[4-(2,5-dimethoxyphenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile (PubChem CID 6906089) has the molecular formula C27H24N4O2S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[(E)-[4-(2,5-dimethoxyphenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile.
| Compound Name | 4-[(E)-[4-(2,5-dimethoxyphenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 6906089 |
| Molecular Formula | C27H24N4O2S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-[(E)-[4-(2,5-dimethoxyphenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3cccc(C)c3C)n2/N=C/c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C27H24N4O2S/c1-18-6-5-7-24(19(18)2)30-27-31(29-16-21-10-8-20(15-28)9-11-21)25(17-34-27)23-14-22(32-3)12-13-26(23)33-4/h5-14,16-17H,1-4H3/b29-16+,30-27- |
| InChIKey | TVWZIISSYIKVTL-YPTIXRBSSA-N |
| XLogP | 5.84 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|