C20H19FN4O2S — CID 42937068
N-[4-[(E)-[4-(5-fluoro-2-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenyl]acetamide (PubChem CID 42937068) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[4-[(E)-[4-(5-fluoro-2-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-[4-(5-fluoro-2-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 42937068 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[4-[(E)-[4-(5-fluoro-2-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenyl]acetamide |
| SMILES | C/N=c1\scc(-c2cc(F)ccc2OC)n1/N=C/c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C20H19FN4O2S/c1-13(26)24-16-7-4-14(5-8-16)11-23-25-18(12-28-20(25)22-2)17-10-15(21)6-9-19(17)27-3/h4-12H,1-3H3,(H,24,26)/b22-20-,23-11+ |
| InChIKey | DGHJPYCQNFTJDG-KXYWVBGFSA-N |
| XLogP | 3.74 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|