C21H21N3OS2 — CID 23824278
4-(2-methoxyphenyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23824278) has the molecular formula C21H21N3OS2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(2-methoxyphenyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23824278 |
| Molecular Formula | C21H21N3OS2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 4-(2-methoxyphenyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccccc2OC)n1N=Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C21H21N3OS2/c1-4-13-22-21-24(23-14-16-9-11-17(26-3)12-10-16)19(15-27-21)18-7-5-6-8-20(18)25-2/h4-12,14-15H,1,13H2,2-3H3/b22-21-,23-14? |
| InChIKey | PNDGTPDQVYEAGR-ZVQXNALJSA-N |
| XLogP | 4.92 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|