C22H18N4S — CID 23823524
4-naphthalen-1-yl-N-prop-2-enyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23823524) has the molecular formula C22H18N4S and a molecular weight of 370.48 g/mol. Its IUPAC name is 4-naphthalen-1-yl-N-prop-2-enyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-naphthalen-1-yl-N-prop-2-enyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23823524 |
| Molecular Formula | C22H18N4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-naphthalen-1-yl-N-prop-2-enyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cccc3ccccc23)n1N=Cc1ccncc1 |
| InChI | InChI=1S/C22H18N4S/c1-2-12-24-22-26(25-15-17-10-13-23-14-11-17)21(16-27-22)20-9-5-7-18-6-3-4-8-19(18)20/h2-11,13-16H,1,12H2/b24-22-,25-15? |
| InChIKey | OQXJGPWQOQJZKR-XVOUCCLWSA-N |
| XLogP | 4.73 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|