C18H17BrN4S — CID 6905400
(E)-4-(2-bromophenyl)-N-propan-2-yl-3-[(E)-pyridin-4-ylmethylideneamino]-1,3-thiazol-2-imine (PubChem CID 6905400) has the molecular formula C18H17BrN4S and a molecular weight of 401.33 g/mol. Its IUPAC name is (E)-4-(2-bromophenyl)-N-propan-2-yl-3-[(E)-pyridin-4-ylmethylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (E)-4-(2-bromophenyl)-N-propan-2-yl-3-[(E)-pyridin-4-ylmethylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6905400 |
| Molecular Formula | C18H17BrN4S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (E)-4-(2-bromophenyl)-N-propan-2-yl-3-[(E)-pyridin-4-ylmethylideneamino]-1,3-thiazol-2-imine |
| SMILES | CC(C)/N=c1\scc(-c2ccccc2Br)n1/N=C/c1ccncc1 |
| InChI | InChI=1S/C18H17BrN4S/c1-13(2)22-18-23(21-11-14-7-9-20-10-8-14)17(12-24-18)15-5-3-4-6-16(15)19/h3-13H,1-2H3/b21-11+,22-18- |
| InChIKey | PKQCDLQYIREFNB-ITJYHKESSA-N |
| XLogP | 4.57 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|