C17H14BrN3S2 — CID 23935911
4-(2-bromophenyl)-N-prop-2-enyl-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23935911) has the molecular formula C17H14BrN3S2 and a molecular weight of 404.36 g/mol. Its IUPAC name is 4-(2-bromophenyl)-N-prop-2-enyl-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(2-bromophenyl)-N-prop-2-enyl-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23935911 |
| Molecular Formula | C17H14BrN3S2 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 4-(2-bromophenyl)-N-prop-2-enyl-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccccc2Br)n1N=Cc1ccsc1 |
| InChI | InChI=1S/C17H14BrN3S2/c1-2-8-19-17-21(20-10-13-7-9-22-11-13)16(12-23-17)14-5-3-4-6-15(14)18/h2-7,9-12H,1,8H2/b19-17-,20-10? |
| InChIKey | GSCXYXBGCOQITK-FCJVRLCASA-N |
| XLogP | 5.01 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|