C18H13BrF3N3S2 — CID 2495006
4-(5-bromothiophen-2-yl)-N-prop-2-enyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-imine (PubChem CID 2495006) has the molecular formula C18H13BrF3N3S2 and a molecular weight of 472.36 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-N-prop-2-enyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(5-bromothiophen-2-yl)-N-prop-2-enyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2495006 |
| Molecular Formula | C18H13BrF3N3S2 |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 470.97 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-N-prop-2-enyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(Br)s2)n1N=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13BrF3N3S2/c1-2-8-23-17-25(14(11-26-17)15-6-7-16(19)27-15)24-10-12-4-3-5-13(9-12)18(20,21)22/h2-7,9-11H,1,8H2/b23-17-,24-10? |
| InChIKey | VRCFZFRSNLJNPG-TYOFJABNSA-N |
| XLogP | 6.03 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|