C19H15BrF3N3S — CID 4318026
4-(4-bromophenyl)-N-ethyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-imine (PubChem CID 4318026) has the molecular formula C19H15BrF3N3S and a molecular weight of 454.32 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-ethyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(4-bromophenyl)-N-ethyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4318026 |
| Molecular Formula | C19H15BrF3N3S |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 4-(4-bromophenyl)-N-ethyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc(Br)cc2)n1N=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15BrF3N3S/c1-2-24-18-26(17(12-27-18)14-6-8-16(20)9-7-14)25-11-13-4-3-5-15(10-13)19(21,22)23/h3-12H,2H2,1H3/b24-18-,25-11? |
| InChIKey | SECVKVDOLFQRBE-NTKHILRHSA-N |
| XLogP | 5.80 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|