C21H20FN3S — CID 23909173
4-(3,4-dimethylphenyl)-3-[(4-fluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23909173) has the molecular formula C21H20FN3S and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-3-[(4-fluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(3,4-dimethylphenyl)-3-[(4-fluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23909173 |
| Molecular Formula | C21H20FN3S |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-3-[(4-fluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(C)c(C)c2)n1N=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN3S/c1-4-11-23-21-25(24-13-17-6-9-19(22)10-7-17)20(14-26-21)18-8-5-15(2)16(3)12-18/h4-10,12-14H,1,11H2,2-3H3/b23-21-,24-13? |
| InChIKey | YWQNYQZHKYZABJ-NYHUNQEVSA-N |
| XLogP | 4.94 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|