C19H14ClF2N3S — CID 23876645
4-(3-chlorophenyl)-3-[(3,4-difluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23876645) has the molecular formula C19H14ClF2N3S and a molecular weight of 389.86 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-[(3,4-difluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(3-chlorophenyl)-3-[(3,4-difluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23876645 |
| Molecular Formula | C19H14ClF2N3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 4-(3-chlorophenyl)-3-[(3,4-difluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cccc(Cl)c2)n1N=Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H14ClF2N3S/c1-2-8-23-19-25(24-11-13-6-7-16(21)17(22)9-13)18(12-26-19)14-4-3-5-15(20)10-14/h2-7,9-12H,1,8H2/b23-19-,24-11? |
| InChIKey | PJVLVLLFGHRVJU-JVITWNBDSA-N |
| XLogP | 5.12 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|