C22H21Cl2N3O3S — CID 23852726
4-(2,4-dichlorophenyl)-N-prop-2-enyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23852726) has the molecular formula C22H21Cl2N3O3S and a molecular weight of 478.40 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-prop-2-enyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-prop-2-enyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23852726 |
| Molecular Formula | C22H21Cl2N3O3S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-prop-2-enyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(Cl)cc2Cl)n1N=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H21Cl2N3O3S/c1-5-8-25-22-27(18(13-31-22)16-7-6-15(23)11-17(16)24)26-12-14-9-19(28-2)21(30-4)20(10-14)29-3/h5-7,9-13H,1,8H2,2-4H3/b25-22-,26-12? |
| InChIKey | ZIMIFJDSUYMFAU-WUIFGJMWSA-N |
| XLogP | 5.52 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|