C23H25N3O5S — CID 135832347
4-methoxy-2-[[2-prop-2-enylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135832347) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 4-methoxy-2-[[2-prop-2-enylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 4-methoxy-2-[[2-prop-2-enylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135832347 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 4-methoxy-2-[[2-prop-2-enylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | C=CC/N=c1\scc(-c2cc(OC)c(OC)c(OC)c2)n1N=Cc1cc(OC)ccc1O |
| InChI | InChI=1S/C23H25N3O5S/c1-6-9-24-23-26(25-13-16-10-17(28-2)7-8-19(16)27)18(14-32-23)15-11-20(29-3)22(31-5)21(12-15)30-4/h6-8,10-14,27H,1,9H2,2-5H3/b24-23-,25-13? |
| InChIKey | KEYKVJLNFBJMDZ-WTBSZUDJSA-N |
| XLogP | 3.93 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|