C25H29N3O4S — CID 135840434
2-[[2-cyclohexylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135840434) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-[[2-cyclohexylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2-[[2-cyclohexylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135840434 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[[2-cyclohexylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | COc1cc(-c2cs/c(=N\C3CCCCC3)n2N=Cc2ccccc2O)cc(OC)c1OC |
| InChI | InChI=1S/C25H29N3O4S/c1-30-22-13-18(14-23(31-2)24(22)32-3)20-16-33-25(27-19-10-5-4-6-11-19)28(20)26-15-17-9-7-8-12-21(17)29/h7-9,12-16,19,29H,4-6,10-11H2,1-3H3/b26-15?,27-25- |
| InChIKey | GXKHHRHITHQXRO-IQWDEYKRSA-N |
| XLogP | 5.06 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|