C22H23N3O5S — CID 46698925
4-[2-cyclopropylimino-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 46698925) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-[2-cyclopropylimino-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-cyclopropylimino-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 46698925 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-[2-cyclopropylimino-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | COc1cc(/C=N/n2c(-c3ccc(O)cc3O)cs/c2=N\C2CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H23N3O5S/c1-28-19-8-13(9-20(29-2)21(19)30-3)11-23-25-17(12-31-22(25)24-14-4-5-14)16-7-6-15(26)10-18(16)27/h6-12,14,26-27H,4-5H2,1-3H3/b23-11+,24-22- |
| InChIKey | NRCIEXBBIKABFI-BEQDUNLMSA-N |
| XLogP | 3.60 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|