C26H31N3O4S — CID 135822869
4-[[2-cyclohexylimino-4-(2,5-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-2-ethoxyphenol (PubChem CID 135822869) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is 4-[[2-cyclohexylimino-4-(2,5-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-2-ethoxyphenol.
| Compound Name | 4-[[2-cyclohexylimino-4-(2,5-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 135822869 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 4-[[2-cyclohexylimino-4-(2,5-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-2-ethoxyphenol |
| SMILES | CCOc1cc(C=Nn2c(-c3cc(OC)ccc3OC)cs/c2=N\C2CCCCC2)ccc1O |
| InChI | InChI=1S/C26H31N3O4S/c1-4-33-25-14-18(10-12-23(25)30)16-27-29-22(21-15-20(31-2)11-13-24(21)32-3)17-34-26(29)28-19-8-6-5-7-9-19/h10-17,19,30H,4-9H2,1-3H3/b27-16?,28-26- |
| InChIKey | QASPRZXRADFEIW-KBORWPLXSA-N |
| XLogP | 5.45 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|