C22H29N3O2S — CID 23936843
N-cyclohexyl-3-(cyclopentylideneamino)-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23936843) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is N-cyclohexyl-3-(cyclopentylideneamino)-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-cyclohexyl-3-(cyclopentylideneamino)-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23936843 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-cyclohexyl-3-(cyclopentylideneamino)-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-c2cs/c(=N\C3CCCCC3)n2N=C2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C22H29N3O2S/c1-26-18-12-13-19(21(14-18)27-2)20-15-28-22(23-16-8-4-3-5-9-16)25(20)24-17-10-6-7-11-17/h12-16H,3-11H2,1-2H3/b23-22- |
| InChIKey | IVANUJJOWXVTHH-FCQUAONHSA-N |
| XLogP | 5.25 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|