C22H24N4OS — CID 23878887
N-cyclohexyl-4-(2-methoxyphenyl)-3-(pyridin-3-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23878887) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is N-cyclohexyl-4-(2-methoxyphenyl)-3-(pyridin-3-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-cyclohexyl-4-(2-methoxyphenyl)-3-(pyridin-3-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23878887 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-cyclohexyl-4-(2-methoxyphenyl)-3-(pyridin-3-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | COc1ccccc1-c1cs/c(=N\C2CCCCC2)n1N=Cc1cccnc1 |
| InChI | InChI=1S/C22H24N4OS/c1-27-21-12-6-5-11-19(21)20-16-28-22(25-18-9-3-2-4-10-18)26(20)24-15-17-8-7-13-23-14-17/h5-8,11-16,18H,2-4,9-10H2,1H3/b24-15?,25-22- |
| InChIKey | HWMBGGWWLQKQOK-XIFUBYQZSA-N |
| XLogP | 4.74 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|