C21H18N4O2S2 — CID 23823582
4-(2,4-dimethoxyphenyl)-N-pyridin-3-yl-3-(thiophen-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23823582) has the molecular formula C21H18N4O2S2 and a molecular weight of 422.54 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-pyridin-3-yl-3-(thiophen-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-pyridin-3-yl-3-(thiophen-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23823582 |
| Molecular Formula | C21H18N4O2S2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-pyridin-3-yl-3-(thiophen-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-c2cs/c(=N\c3cccnc3)n2N=Cc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C21H18N4O2S2/c1-26-16-7-8-18(20(11-16)27-2)19-14-29-21(24-15-5-3-9-22-12-15)25(19)23-13-17-6-4-10-28-17/h3-14H,1-2H3/b23-13?,24-21- |
| InChIKey | CQXIZHQRWJQQPG-HKQCODESSA-N |
| XLogP | 4.80 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|