C21H22BrN3O2S2 — CID 135666214
2-bromo-4-[(2-cyclohexylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]-6-methoxyphenol (PubChem CID 135666214) has the molecular formula C21H22BrN3O2S2 and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-bromo-4-[(2-cyclohexylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[(2-cyclohexylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135666214 |
| Molecular Formula | C21H22BrN3O2S2 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | 2-bromo-4-[(2-cyclohexylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(C=Nn2c(-c3cccs3)cs/c2=N\C2CCCCC2)cc(Br)c1O |
| InChI | InChI=1S/C21H22BrN3O2S2/c1-27-18-11-14(10-16(22)20(18)26)12-23-25-17(19-8-5-9-28-19)13-29-21(25)24-15-6-3-2-4-7-15/h5,8-13,15,26H,2-4,6-7H2,1H3/b23-12?,24-21- |
| InChIKey | INHUQHLMLOHDFI-XPNISKNYSA-N |
| XLogP | 5.87 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|