C21H22BrN3O2S — CID 135838830
2-bromo-6-methoxy-4-[[4-(4-methylphenyl)-2-propan-2-ylimino-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135838830) has the molecular formula C21H22BrN3O2S and a molecular weight of 460.40 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[[4-(4-methylphenyl)-2-propan-2-ylimino-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[[4-(4-methylphenyl)-2-propan-2-ylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135838830 |
| Molecular Formula | C21H22BrN3O2S |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 2-bromo-6-methoxy-4-[[4-(4-methylphenyl)-2-propan-2-ylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | COc1cc(C=Nn2c(-c3ccc(C)cc3)cs/c2=N\C(C)C)cc(Br)c1O |
| InChI | InChI=1S/C21H22BrN3O2S/c1-13(2)24-21-25(18(12-28-21)16-7-5-14(3)6-8-16)23-11-15-9-17(22)20(26)19(10-15)27-4/h5-13,26H,1-4H3/b23-11?,24-21- |
| InChIKey | AUBHXMQUONOYDN-KNAIGVLWSA-N |
| XLogP | 5.19 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|