C19H18BrN3O3S — CID 135691252
2-bromo-6-methoxy-4-[(E)-[4-(4-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135691252) has the molecular formula C19H18BrN3O3S and a molecular weight of 448.34 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(E)-[4-(4-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(E)-[4-(4-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135691252 |
| Molecular Formula | C19H18BrN3O3S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(E)-[4-(4-methoxyphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | C/N=c1\scc(-c2ccc(OC)cc2)n1/N=C/c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C19H18BrN3O3S/c1-21-19-23(16(11-27-19)13-4-6-14(25-2)7-5-13)22-10-12-8-15(20)18(24)17(9-12)26-3/h4-11,24H,1-3H3/b21-19-,22-10+ |
| InChIKey | GUEOIJGEXZDJEI-JOJRYIPASA-N |
| XLogP | 4.11 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|