C24H25F2N3OS — CID 4848240
N-cyclohexyl-4-[4-(difluoromethoxy)phenyl]-3-[(3-methylphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 4848240) has the molecular formula C24H25F2N3OS and a molecular weight of 441.55 g/mol. Its IUPAC name is N-cyclohexyl-4-[4-(difluoromethoxy)phenyl]-3-[(3-methylphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | N-cyclohexyl-4-[4-(difluoromethoxy)phenyl]-3-[(3-methylphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4848240 |
| Molecular Formula | C24H25F2N3OS |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-cyclohexyl-4-[4-(difluoromethoxy)phenyl]-3-[(3-methylphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | Cc1cccc(C=Nn2c(-c3ccc(OC(F)F)cc3)cs/c2=N\C2CCCCC2)c1 |
| InChI | InChI=1S/C24H25F2N3OS/c1-17-6-5-7-18(14-17)15-27-29-22(19-10-12-21(13-11-19)30-23(25)26)16-31-24(29)28-20-8-3-2-4-9-20/h5-7,10-16,20,23H,2-4,8-9H2,1H3/b27-15?,28-24- |
| InChIKey | FZFFVDCXWRCREZ-FOMGGBCHSA-N |
| XLogP | 6.24 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|