C23H25N3O2S — CID 135582260
4-[[2-cyclohexylimino-4-(4-methylphenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol (PubChem CID 135582260) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-[[2-cyclohexylimino-4-(4-methylphenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol.
| Compound Name | 4-[[2-cyclohexylimino-4-(4-methylphenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135582260 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-[[2-cyclohexylimino-4-(4-methylphenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
| SMILES | Cc1ccc(-c2cs/c(=N\C3CCCCC3)n2N=Cc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-16-7-10-18(11-8-16)20-15-29-23(25-19-5-3-2-4-6-19)26(20)24-14-17-9-12-21(27)22(28)13-17/h7-15,19,27-28H,2-6H2,1H3/b24-14?,25-23- |
| InChIKey | NHBRJTCIRUKGPF-RVMWZDJSSA-N |
| XLogP | 5.05 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|