C20H25N3O2S — CID 137289063
2-[(E)-(2-cyclohexylimino-4-cyclopropyl-1,3-thiazol-3-yl)iminomethyl]-5-methylbenzene-1,4-diol (PubChem CID 137289063) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[(E)-(2-cyclohexylimino-4-cyclopropyl-1,3-thiazol-3-yl)iminomethyl]-5-methylbenzene-1,4-diol.
| Compound Name | 2-[(E)-(2-cyclohexylimino-4-cyclopropyl-1,3-thiazol-3-yl)iminomethyl]-5-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 137289063 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[(E)-(2-cyclohexylimino-4-cyclopropyl-1,3-thiazol-3-yl)iminomethyl]-5-methylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(/C=N/n2c(C3CC3)cs/c2=N\C2CCCCC2)cc1O |
| InChI | InChI=1S/C20H25N3O2S/c1-13-9-19(25)15(10-18(13)24)11-21-23-17(14-7-8-14)12-26-20(23)22-16-5-3-2-4-6-16/h9-12,14,16,24-25H,2-8H2,1H3/b21-11+,22-20- |
| InChIKey | WCIXIBFZSHSSEC-GRWXYWTESA-N |
| XLogP | 4.26 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|