C19H22N4O3S — CID 137289071
4-[(E)-(2-cyclohexylimino-4-cyclopropyl-1,3-thiazol-3-yl)iminomethyl]-6-nitrosobenzene-1,3-diol (PubChem CID 137289071) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-[(E)-(2-cyclohexylimino-4-cyclopropyl-1,3-thiazol-3-yl)iminomethyl]-6-nitrosobenzene-1,3-diol.
| Compound Name | 4-[(E)-(2-cyclohexylimino-4-cyclopropyl-1,3-thiazol-3-yl)iminomethyl]-6-nitrosobenzene-1,3-diol |
|---|---|
| PubChem CID | 137289071 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-[(E)-(2-cyclohexylimino-4-cyclopropyl-1,3-thiazol-3-yl)iminomethyl]-6-nitrosobenzene-1,3-diol |
| SMILES | O=Nc1cc(/C=N/n2c(C3CC3)cs/c2=N\C2CCCCC2)c(O)cc1O |
| InChI | InChI=1S/C19H22N4O3S/c24-17-9-18(25)15(22-26)8-13(17)10-20-23-16(12-6-7-12)11-27-19(23)21-14-4-2-1-3-5-14/h8-12,14,24-25H,1-7H2/b20-10+,21-19- |
| InChIKey | YWKXNQGMMJKXOT-LELOSUNBSA-N |
| XLogP | 4.35 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|