C22H22BrN3OS — CID 5126572
4-(4-bromophenyl)-3-[(4-methylphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine (PubChem CID 5126572) has the molecular formula C22H22BrN3OS and a molecular weight of 456.41 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-[(4-methylphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-bromophenyl)-3-[(4-methylphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5126572 |
| Molecular Formula | C22H22BrN3OS |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 4-(4-bromophenyl)-3-[(4-methylphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(C=Nn2c(-c3ccc(Br)cc3)cs/c2=N\CC2CCCO2)cc1 |
| InChI | InChI=1S/C22H22BrN3OS/c1-16-4-6-17(7-5-16)13-25-26-21(18-8-10-19(23)11-9-18)15-28-22(26)24-14-20-3-2-12-27-20/h4-11,13,15,20H,2-3,12,14H2,1H3/b24-22-,25-13? |
| InChIKey | QJEWFMOMHGMGEX-ZJDDHNLJSA-N |
| XLogP | 5.25 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|