C21H19ClFN3OS — CID 5218409
4-(4-chlorophenyl)-3-[(4-fluorophenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine (PubChem CID 5218409) has the molecular formula C21H19ClFN3OS and a molecular weight of 415.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-[(4-fluorophenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-chlorophenyl)-3-[(4-fluorophenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5218409 |
| Molecular Formula | C21H19ClFN3OS |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-(4-chlorophenyl)-3-[(4-fluorophenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(C=Nn2c(-c3ccc(Cl)cc3)cs/c2=N\CC2CCCO2)cc1 |
| InChI | InChI=1S/C21H19ClFN3OS/c22-17-7-5-16(6-8-17)20-14-28-21(24-13-19-2-1-11-27-19)26(20)25-12-15-3-9-18(23)10-4-15/h3-10,12,14,19H,1-2,11,13H2/b24-21-,25-12? |
| InChIKey | SGUQIUPSLMFTQG-LAQSFASPSA-N |
| XLogP | 4.97 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|